About 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine
2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine (PubChem CID 22181660) has the molecular formula C14H16FN5
and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine |
| PubChem CID | 22181660 |
| Molecular Formula | C14H16FN5 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine |
| SMILES | CCC(c1ncc[nH]1)n1ccnc1C1=CC=CC(F)N1 |
| InChI | InChI=1S/C14H16FN5/c1-2-11(13-16-6-7-17-13)20-9-8-18-14(20)10-4-3-5-12(15)19-10/h3-9,11-12,19H,2H2,1H3,(H,16,17) |
| InChIKey | XJVPJWMDEKXGNV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine?
The IUPAC name of 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine (CID 22181660) is 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine.
What is the SMILES notation for 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine?
The canonical SMILES for 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine is CCC(c1ncc[nH]1)n1ccnc1C1=CC=CC(F)N1.
What is the InChIKey of 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine?
The InChIKey is XJVPJWMDEKXGNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN5/c1-2-11(13-16-6-7-17-13)20-9-8-18-14(20)10-4-3-5-12(15)19-10/h3-9,11-12,19H,2H2,1H3,(H,16,17).
What are the key properties of 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine?
2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine has a molecular weight of 273.31 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[1-[1-(1H-imidazol-2-yl)propyl]imidazol-2-yl]-1,2-dihydropyridine is sourced from PubChem (CID 22181660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).