C21H6Br9N3O3 — CID 22182121
4,5,6-tris(2,3,4-tribromophenoxy)triazine (PubChem CID 22182121) has the molecular formula C21H6Br9N3O3 and a molecular weight of 1067.43 g/mol. Its IUPAC name is 4,5,6-tris(2,3,4-tribromophenoxy)triazine.
| Compound Name | 4,5,6-tris(2,3,4-tribromophenoxy)triazine |
|---|---|
| PubChem CID | 22182121 |
| Molecular Formula | C21H6Br9N3O3 |
| Molecular Weight | 1067.43 g/mol |
| Exact Mass | 1058.31 |
| IUPAC Name | 4,5,6-tris(2,3,4-tribromophenoxy)triazine |
| SMILES | Brc1ccc(Oc2nnnc(Oc3ccc(Br)c(Br)c3Br)c2Oc2ccc(Br)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C21H6Br9N3O3/c22-7-1-4-10(16(28)13(7)25)34-19-20(35-11-5-2-8(23)14(26)17(11)29)31-33-32-21(19)36-12-6-3-9(24)15(27)18(12)30/h1-6H |
| InChIKey | CRGHZGPGIPFJID-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.43 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|