About 1-N'-methylpropane-1,1-diamine
1-N'-methylpropane-1,1-diamine (PubChem CID 22182297) has the molecular formula C4H12N2
and a molecular weight of 88.15 g/mol. Its IUPAC name is 1-N'-methylpropane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-methylpropane-1,1-diamine |
| PubChem CID | 22182297 |
| Molecular Formula | C4H12N2 |
| Molecular Weight | 88.15 g/mol |
| Exact Mass | 88.10 |
| IUPAC Name | 1-N'-methylpropane-1,1-diamine |
| SMILES | CCC(N)NC |
| InChI | InChI=1S/C4H12N2/c1-3-4(5)6-2/h4,6H,3,5H2,1-2H3 |
| InChIKey | OMMKTOYORLTRPN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-methylpropane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-methylpropane-1,1-diamine?
The IUPAC name of 1-N'-methylpropane-1,1-diamine (CID 22182297) is 1-N'-methylpropane-1,1-diamine.
What is the SMILES notation for 1-N'-methylpropane-1,1-diamine?
The canonical SMILES for 1-N'-methylpropane-1,1-diamine is CCC(N)NC.
What is the InChIKey of 1-N'-methylpropane-1,1-diamine?
The InChIKey is OMMKTOYORLTRPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2/c1-3-4(5)6-2/h4,6H,3,5H2,1-2H3.
What are the key properties of 1-N'-methylpropane-1,1-diamine?
1-N'-methylpropane-1,1-diamine has a molecular weight of 88.15 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-methylpropane-1,1-diamine is sourced from PubChem (CID 22182297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).