C23H26F2N4S — CID 22182426
N-[1-[1-(2,6-difluorophenyl)ethyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 22182426) has the molecular formula C23H26F2N4S and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[1-[1-(2,6-difluorophenyl)ethyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[1-(2,6-difluorophenyl)ethyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22182426 |
| Molecular Formula | C23H26F2N4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[1-[1-(2,6-difluorophenyl)ethyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(c1c(F)cccc1F)N1CCC(Nc2ncnc3sc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C23H26F2N4S/c1-14(20-17(24)6-4-7-18(20)25)29-11-9-15(10-12-29)28-22-21-16-5-2-3-8-19(16)30-23(21)27-13-26-22/h4,6-7,13-15H,2-3,5,8-12H2,1H3,(H,26,27,28) |
| InChIKey | XVTDKXXDFXHHJE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |