About (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate
(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate (PubChem CID 22182802) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate |
| PubChem CID | 22182802 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C14H26O3/c1-5-12(15)14(16)17-13-8-10(4)6-7-11(13)9(2)3/h9-13,15H,5-8H2,1-4H3 |
| InChIKey | ISCZJZIPPSZYRD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate (CID 22182802) is (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate is CCC(O)C(=O)OC1CC(C)CCC1C(C)C.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate?
The InChIKey is ISCZJZIPPSZYRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-5-12(15)14(16)17-13-8-10(4)6-7-11(13)9(2)3/h9-13,15H,5-8H2,1-4H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate?
(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate has a molecular weight of 242.36 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxybutanoate is sourced from PubChem (CID 22182802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).