About 5-methylhexyl acetate
5-methylhexyl acetate (PubChem CID 22182954) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 5-methylhexyl acetate.
Molecular Properties
| Compound Name | 5-methylhexyl acetate |
| PubChem CID | 22182954 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 5-methylhexyl acetate |
| SMILES | CC(=O)OCCCCC(C)C |
| InChI | InChI=1S/C9H18O2/c1-8(2)6-4-5-7-11-9(3)10/h8H,4-7H2,1-3H3 |
| InChIKey | OOYBITFWBADNKC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexyl acetate?
The IUPAC name of 5-methylhexyl acetate (CID 22182954) is 5-methylhexyl acetate.
What is the SMILES notation for 5-methylhexyl acetate?
The canonical SMILES for 5-methylhexyl acetate is CC(=O)OCCCCC(C)C.
What is the InChIKey of 5-methylhexyl acetate?
The InChIKey is OOYBITFWBADNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-8(2)6-4-5-7-11-9(3)10/h8H,4-7H2,1-3H3.
What are the key properties of 5-methylhexyl acetate?
5-methylhexyl acetate has a molecular weight of 158.24 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexyl acetate is sourced from PubChem (CID 22182954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).