About 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine
4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine (PubChem CID 22183031) has the molecular formula C20H38N4O5
and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine.
Molecular Properties
| Compound Name | 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine |
| PubChem CID | 22183031 |
| Molecular Formula | C20H38N4O5 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine |
| SMILES | CC(OC(C)(N1CCOCC1)N1CCOCC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C20H38N4O5/c1-19(21-3-11-25-12-4-21,22-5-13-26-14-6-22)29-20(2,23-7-15-27-16-8-23)24-9-17-28-18-10-24/h3-18H2,1-2H3 |
| InChIKey | HIYLWKRLRGECKC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 59.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine?
The IUPAC name of 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine (CID 22183031) is 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine.
What is the SMILES notation for 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine?
The canonical SMILES for 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine is CC(OC(C)(N1CCOCC1)N1CCOCC1)(N1CCOCC1)N1CCOCC1.
What is the InChIKey of 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine?
The InChIKey is HIYLWKRLRGECKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38N4O5/c1-19(21-3-11-25-12-4-21,22-5-13-26-14-6-22)29-20(2,23-7-15-27-16-8-23)24-9-17-28-18-10-24/h3-18H2,1-2H3.
What are the key properties of 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine?
4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine has a molecular weight of 414.55 g/mol, XLogP of -0.32, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,1-dimorpholin-4-ylethoxy)-1-morpholin-4-ylethyl]morpholine is sourced from PubChem (CID 22183031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).