C20H20Cl3O3P — CID 22183187
(2,6-dimethylphenyl)-[2-methylpropyl-(2,4,6-trichlorobenzoyl)phosphoryl]methanone (PubChem CID 22183187) has the molecular formula C20H20Cl3O3P and a molecular weight of 445.71 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-[2-methylpropyl-(2,4,6-trichlorobenzoyl)phosphoryl]methanone.
| Compound Name | (2,6-dimethylphenyl)-[2-methylpropyl-(2,4,6-trichlorobenzoyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 22183187 |
| Molecular Formula | C20H20Cl3O3P |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | (2,6-dimethylphenyl)-[2-methylpropyl-(2,4,6-trichlorobenzoyl)phosphoryl]methanone |
| SMILES | Cc1cccc(C)c1C(=O)P(=O)(CC(C)C)C(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl3O3P/c1-11(2)10-27(26,19(24)17-12(3)6-5-7-13(17)4)20(25)18-15(22)8-14(21)9-16(18)23/h5-9,11H,10H2,1-4H3 |
| InChIKey | OAEJLVUDUAOSKX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|