C19H31O2P — CID 22183541
[butyl(pentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 22183541) has the molecular formula C19H31O2P and a molecular weight of 322.43 g/mol. Its IUPAC name is [butyl(pentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [butyl(pentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183541 |
| Molecular Formula | C19H31O2P |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [butyl(pentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCCP(=O)(CCCC)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H31O2P/c1-6-8-10-12-22(21,11-9-7-2)19(20)18-16(4)13-15(3)14-17(18)5/h13-14H,6-12H2,1-5H3 |
| InChIKey | MBXHTANZXOOOAE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|