C23H23F6O6P — CID 22183706
[2,6-bis(trifluoromethyl)phenyl]-[2-methylpropyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone (PubChem CID 22183706) has the molecular formula C23H23F6O6P and a molecular weight of 540.39 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-[2-methylpropyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-[2-methylpropyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 22183706 |
| Molecular Formula | C23H23F6O6P |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-[2-methylpropyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone |
| SMILES | COc1cc(OC)c(C(=O)P(=O)(CC(C)C)C(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C23H23F6O6P/c1-12(2)11-36(32,21(31)19-16(34-4)9-13(33-3)10-17(19)35-5)20(30)18-14(22(24,25)26)7-6-8-15(18)23(27,28)29/h6-10,12H,11H2,1-5H3 |
| InChIKey | BUVPJWFVTLCPNZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|