C21H26N4O5 — CID 22184814
Ethyl 4-[2-[(4-ethoxyquinoline-2-carbonyl)amino]acetyl]piperazine-1-carboxylate (PubChem CID 22184814) has the molecular formula C21H26N4O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 4-[2-[(4-ethoxyquinoline-2-carbonyl)amino]acetyl]piperazine-1-carboxylate.
| Compound Name | Ethyl 4-[2-[(4-ethoxyquinoline-2-carbonyl)amino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22184814 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethyl 4-[2-[(4-ethoxyquinoline-2-carbonyl)amino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC1=CC(=NC2=CC=CC=C21)C(=O)NCC(=O)N3CCN(CC3)C(=O)OCC |
| InChI | InChI=1S/C21H26N4O5/c1-3-29-18-13-17(23-16-8-6-5-7-15(16)18)20(27)22-14-19(26)24-9-11-25(12-10-24)21(28)30-4-2/h5-8,13H,3-4,9-12,14H2,1-2H3,(H,22,27) |
| InChIKey | AIXKVYMCIOALBB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | 608 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |