C25H28N4O8 — CID 22185097
4-[[4-[(E)-2-carboxyethenyl]quinoline-2-carbonyl]amino]-5-(4-ethoxycarbonylpiperazin-1-yl)-5-oxopentanoic acid (PubChem CID 22185097) has the molecular formula C25H28N4O8 and a molecular weight of 512.52 g/mol. Its IUPAC name is 4-[[4-[(E)-2-carboxyethenyl]quinoline-2-carbonyl]amino]-5-(4-ethoxycarbonylpiperazin-1-yl)-5-oxopentanoic acid.
| Compound Name | 4-[[4-[(E)-2-carboxyethenyl]quinoline-2-carbonyl]amino]-5-(4-ethoxycarbonylpiperazin-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22185097 |
| Molecular Formula | C25H28N4O8 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-[[4-[(E)-2-carboxyethenyl]quinoline-2-carbonyl]amino]-5-(4-ethoxycarbonylpiperazin-1-yl)-5-oxopentanoic acid |
| SMILES | CCOC(=O)N1CCN(C(=O)C(CCC(=O)O)NC(=O)c2cc(/C=C/C(=O)O)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H28N4O8/c1-2-37-25(36)29-13-11-28(12-14-29)24(35)19(8-10-22(32)33)27-23(34)20-15-16(7-9-21(30)31)17-5-3-4-6-18(17)26-20/h3-7,9,15,19H,2,8,10-14H2,1H3,(H,27,34)(H,30,31)(H,32,33)/b9-7+ |
| InChIKey | MPVPVDYUIWNVFU-VQHVLOKHSA-N |
| XLogP | 1.60 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|