About 9-nitropyrido[3,4-b]indole;hydrochloride
9-nitropyrido[3,4-b]indole;hydrochloride (PubChem CID 22185253) has the molecular formula C11H8ClN3O2
and a molecular weight of 249.66 g/mol. Its IUPAC name is 9-nitropyrido[3,4-b]indole;hydrochloride.
Molecular Properties
| Compound Name | 9-nitropyrido[3,4-b]indole;hydrochloride |
| PubChem CID | 22185253 |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 9-nitropyrido[3,4-b]indole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])n1c2ccccc2c2ccncc21 |
| InChI | InChI=1S/C11H7N3O2.ClH/c15-14(16)13-10-4-2-1-3-8(10)9-5-6-12-7-11(9)13;/h1-7H;1H |
| InChIKey | PWMSFQKJBXWZAY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-nitropyrido[3,4-b]indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nitropyrido[3,4-b]indole;hydrochloride?
The IUPAC name of 9-nitropyrido[3,4-b]indole;hydrochloride (CID 22185253) is 9-nitropyrido[3,4-b]indole;hydrochloride.
What is the SMILES notation for 9-nitropyrido[3,4-b]indole;hydrochloride?
The canonical SMILES for 9-nitropyrido[3,4-b]indole;hydrochloride is Cl.O=[N+]([O-])n1c2ccccc2c2ccncc21.
What is the InChIKey of 9-nitropyrido[3,4-b]indole;hydrochloride?
The InChIKey is PWMSFQKJBXWZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2.ClH/c15-14(16)13-10-4-2-1-3-8(10)9-5-6-12-7-11(9)13;/h1-7H;1H.
What are the key properties of 9-nitropyrido[3,4-b]indole;hydrochloride?
9-nitropyrido[3,4-b]indole;hydrochloride has a molecular weight of 249.66 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nitropyrido[3,4-b]indole;hydrochloride is sourced from PubChem (CID 22185253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).