C27H44O9 — CID 22185919
[(4E)-7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 22185919) has the molecular formula C27H44O9 and a molecular weight of 512.64 g/mol. Its IUPAC name is [(4E)-7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 22185919 |
| Molecular Formula | C27H44O9 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | [(4E)-7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCOC(C)OC1CCC(C)(OC(C)OCC)C(OC(C)=O)/C=C/C(C)C(/C(C)=C/C=O)OC(=O)C1 |
| InChI | InChI=1S/C27H44O9/c1-9-31-21(6)34-23-13-15-27(8,36-22(7)32-10-2)24(33-20(5)29)12-11-18(3)26(19(4)14-16-28)35-25(30)17-23/h11-12,14,16,18,21-24,26H,9-10,13,15,17H2,1-8H3/b12-11+,19-14+ |
| InChIKey | NFUSRGGEXZWQTD-OTIKAVQOSA-N |
| XLogP | 4.28 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|