C36H60N2O8 — CID 22185925
[(4Z)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-piperidin-1-ylethyl)carbamate (PubChem CID 22185925) has the molecular formula C36H60N2O8 and a molecular weight of 648.88 g/mol. Its IUPAC name is [(4Z)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-piperidin-1-ylethyl)carbamate.
| Compound Name | [(4Z)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-piperidin-1-ylethyl)carbamate |
|---|---|
| PubChem CID | 22185925 |
| Molecular Formula | C36H60N2O8 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.43 |
| IUPAC Name | [(4Z)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-piperidin-1-ylethyl)carbamate |
| SMILES | CCC(O)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=O)NCCN2CCCCC2)/C=C\C1C |
| InChI | InChI=1S/C36H60N2O8/c1-7-29(40)27(5)34-30(44-34)22-24(2)12-11-13-25(3)33-26(4)14-15-31(36(6,43)17-16-28(39)23-32(41)46-33)45-35(42)37-18-21-38-19-9-8-10-20-38/h11-15,24,26-31,33-34,39-40,43H,7-10,16-23H2,1-6H3,(H,37,42)/b12-11+,15-14-,25-13+ |
| InChIKey | CGSPZDPYEFCUQI-ICKSXXTKSA-N |
| XLogP | 4.67 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|