About cyclooctylcyclooctane;2-methylprop-2-enoic acid
cyclooctylcyclooctane;2-methylprop-2-enoic acid (PubChem CID 22186221) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is cyclooctylcyclooctane;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | cyclooctylcyclooctane;2-methylprop-2-enoic acid |
| PubChem CID | 22186221 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | cyclooctylcyclooctane;2-methylprop-2-enoic acid |
| SMILES | C1CCCC(C2CCCCCCC2)CCC1.C=C(C)C(=O)O |
| InChI | InChI=1S/C16H30.C4H6O2/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16;1-3(2)4(5)6/h15-16H,1-14H2;1H2,2H3,(H,5,6) |
| InChIKey | FRBVPWFUGWQIRS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclooctylcyclooctane;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctylcyclooctane;2-methylprop-2-enoic acid?
The IUPAC name of cyclooctylcyclooctane;2-methylprop-2-enoic acid (CID 22186221) is cyclooctylcyclooctane;2-methylprop-2-enoic acid.
What is the SMILES notation for cyclooctylcyclooctane;2-methylprop-2-enoic acid?
The canonical SMILES for cyclooctylcyclooctane;2-methylprop-2-enoic acid is C1CCCC(C2CCCCCCC2)CCC1.C=C(C)C(=O)O.
What is the InChIKey of cyclooctylcyclooctane;2-methylprop-2-enoic acid?
The InChIKey is FRBVPWFUGWQIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30.C4H6O2/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16;1-3(2)4(5)6/h15-16H,1-14H2;1H2,2H3,(H,5,6).
What are the key properties of cyclooctylcyclooctane;2-methylprop-2-enoic acid?
cyclooctylcyclooctane;2-methylprop-2-enoic acid has a molecular weight of 308.51 g/mol, XLogP of 6.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctylcyclooctane;2-methylprop-2-enoic acid is sourced from PubChem (CID 22186221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).