About (2-ethyl-hexoxy)silane
(2-ethyl-hexoxy)silane (PubChem CID 22186351) has the molecular formula C8H17OSi
and a molecular weight of 157.31 g/mol.
Molecular Properties
| Compound Name | (2-ethyl-hexoxy)silane |
| PubChem CID | 22186351 |
| Molecular Formula | C8H17OSi |
| Molecular Weight | 157.31 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)CO[Si] |
| InChI | InChI=1S/C8H17OSi/c1-3-5-6-8(4-2)7-9-10/h8H,3-7H2,1-2H3 |
| InChIKey | LQHLAMHHCBUQTQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-hexoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-hexoxy)silane?
The IUPAC name of (2-ethyl-hexoxy)silane (CID 22186351) is not available.
What is the SMILES notation for (2-ethyl-hexoxy)silane?
The canonical SMILES for (2-ethyl-hexoxy)silane is CCCCC(CC)CO[Si].
What is the InChIKey of (2-ethyl-hexoxy)silane?
The InChIKey is LQHLAMHHCBUQTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17OSi/c1-3-5-6-8(4-2)7-9-10/h8H,3-7H2,1-2H3.
What are the key properties of (2-ethyl-hexoxy)silane?
(2-ethyl-hexoxy)silane has a molecular weight of 157.31 g/mol, XLogP of 2.30, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-hexoxy)silane is sourced from PubChem (CID 22186351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).