About 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide
2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide (PubChem CID 2218678) has the molecular formula C17H27NO3S
and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide |
| PubChem CID | 2218678 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)CS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H27NO3S/c1-14(2)10-18(11-15(3)4)17(19)13-22(20,21)12-16-8-6-5-7-9-16/h5-9,14-15H,10-13H2,1-4H3 |
| InChIKey | ZQQFXVIQPWCOCQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide?
The IUPAC name of 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide (CID 2218678) is 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide.
What is the SMILES notation for 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide?
The canonical SMILES for 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide is CC(C)CN(CC(C)C)C(=O)CS(=O)(=O)Cc1ccccc1.
What is the InChIKey of 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide?
The InChIKey is ZQQFXVIQPWCOCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3S/c1-14(2)10-18(11-15(3)4)17(19)13-22(20,21)12-16-8-6-5-7-9-16/h5-9,14-15H,10-13H2,1-4H3.
What are the key properties of 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide?
2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide has a molecular weight of 325.47 g/mol, XLogP of 2.74, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfonyl-N,N-bis(2-methylpropyl)acetamide is sourced from PubChem (CID 2218678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).