C23H22N4OS2 — CID 2218750
N-[4-(dimethylamino)phenyl]-2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide (PubChem CID 2218750) has the molecular formula C23H22N4OS2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2218750 |
| Molecular Formula | C23H22N4OS2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide |
| SMILES | Cc1ccc(-c2csc3ncnc(SCC(=O)Nc4ccc(N(C)C)cc4)c23)cc1 |
| InChI | InChI=1S/C23H22N4OS2/c1-15-4-6-16(7-5-15)19-12-29-22-21(19)23(25-14-24-22)30-13-20(28)26-17-8-10-18(11-9-17)27(2)3/h4-12,14H,13H2,1-3H3,(H,26,28) |
| InChIKey | ZIKFSJUCVAEORL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|