C7H4Cl5HgO — CID 22190
methylmercury;2,3,4,5,6-pentachlorophenol (PubChem CID 22190) has the molecular formula C7H4Cl5HgO and a molecular weight of 481.96 g/mol. Its IUPAC name is methylmercury;2,3,4,5,6-pentachlorophenol.
| Compound Name | methylmercury;2,3,4,5,6-pentachlorophenol |
|---|---|
| PubChem CID | 22190 |
| Molecular Formula | C7H4Cl5HgO |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 480.84 |
| IUPAC Name | methylmercury;2,3,4,5,6-pentachlorophenol |
| SMILES | C[Hg].Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O.CH3.Hg/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h12H;1H3; |
| InChIKey | ACBJBUNIAHRWAN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|