C34H32N4O4S — CID 22190034
N-[(Z)-3-[4-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22190034) has the molecular formula C34H32N4O4S and a molecular weight of 592.72 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190034 |
| Molecular Formula | C34H32N4O4S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3ccc(C)cc3)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H32N4O4S/c1-22-9-11-25(12-10-22)21-31(38-33(41)26-7-5-4-6-8-26)34(42)37-29-17-19-30(20-18-29)43-23(2)32(40)36-28-15-13-27(14-16-28)35-24(3)39/h4-21,23H,1-3H3,(H,35,39)(H,36,40)(H,37,42)(H,38,41)/b31-21- |
| InChIKey | AFNOKXMVFOWPDQ-YQYKVWLJSA-N |
| XLogP | 6.48 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|