C40H37N3O3S — CID 22190144
N-[(Z)-1-(4-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22190144) has the molecular formula C40H37N3O3S and a molecular weight of 639.82 g/mol. Its IUPAC name is N-[(Z)-1-(4-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190144 |
| Molecular Formula | C40H37N3O3S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | N-[(Z)-1-(4-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc(C(C)C)cc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C40H37N3O3S/c1-27(2)30-18-20-33(21-19-30)42-40(46)37(31-10-6-4-7-11-31)47-35-24-22-34(23-25-35)41-39(45)36(26-29-16-14-28(3)15-17-29)43-38(44)32-12-8-5-9-13-32/h4-27,37H,1-3H3,(H,41,45)(H,42,46)(H,43,44)/b36-26- |
| InChIKey | XLMYVNZOYKYJOR-QYVLQNAGSA-N |
| XLogP | 9.00 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|