About N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide
N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide (PubChem CID 2219050) has the molecular formula C19H21N5O
and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide |
| PubChem CID | 2219050 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide |
| SMILES | CCCCn1nnc(NC(=O)C(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H21N5O/c1-2-3-14-24-22-19(21-23-24)20-18(25)17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3,(H,20,22,25) |
| InChIKey | QPQNGMRGBDITML-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide?
The IUPAC name of N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide (CID 2219050) is N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide?
The canonical SMILES for N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide is CCCCn1nnc(NC(=O)C(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide?
The InChIKey is QPQNGMRGBDITML-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O/c1-2-3-14-24-22-19(21-23-24)20-18(25)17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3,(H,20,22,25).
What are the key properties of N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide?
N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide has a molecular weight of 335.41 g/mol, XLogP of 3.24, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-butyltetrazol-5-yl)-2,2-diphenylacetamide is sourced from PubChem (CID 2219050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).