C23H23Cl2N3O — CID 22194778
2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-N-naphthalen-1-ylacetamide (PubChem CID 22194778) has the molecular formula C23H23Cl2N3O and a molecular weight of 428.36 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 22194778 |
| Molecular Formula | C23H23Cl2N3O |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-N-naphthalen-1-ylacetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)c(Cl)c2)CC1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H23Cl2N3O/c24-20-9-8-17(14-21(20)25)15-27-10-12-28(13-11-27)16-23(29)26-22-7-3-5-18-4-1-2-6-19(18)22/h1-9,14H,10-13,15-16H2,(H,26,29) |
| InChIKey | LXRHPMZUIWODGB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |