methyl 2-(2,6-dimethylmorpholin-4-yl)acetate

C9H17NO3 — CID 22198251

IUPACmethyl 2-(2,6-dimethylmorpholin-4-yl)acetate
SMILESCOC(=O)CN1CC(C)OC(C)C1
InChIInChI=1S/C9H17NO3/c1-7-4-10(5-8(2)13-7)6-9(11)12-3/h7-8H,4-6H2,1-3H3
InChIKeySQMYBHLEAHRHMZ-UHFFFAOYSA-N
MW187.24 g/mol
LogP0.27
Rot. Bonds2

About methyl 2-(2,6-dimethylmorpholin-4-yl)acetate

methyl 2-(2,6-dimethylmorpholin-4-yl)acetate (PubChem CID 22198251) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is methyl 2-(2,6-dimethylmorpholin-4-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(2,6-dimethylmorpholin-4-yl)acetate
PubChem CID22198251
Molecular FormulaC9H17NO3
Molecular Weight187.24 g/mol
Exact Mass187.12
IUPAC Namemethyl 2-(2,6-dimethylmorpholin-4-yl)acetate
SMILESCOC(=O)CN1CC(C)OC(C)C1
InChIInChI=1S/C9H17NO3/c1-7-4-10(5-8(2)13-7)6-9(11)12-3/h7-8H,4-6H2,1-3H3
InChIKeySQMYBHLEAHRHMZ-UHFFFAOYSA-N
XLogP0.27
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.24
LogP ≤ 50.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,6-dimethylmorpholin-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,6-dimethylmorpholin-4-yl)acetate?
The IUPAC name of methyl 2-(2,6-dimethylmorpholin-4-yl)acetate (CID 22198251) is methyl 2-(2,6-dimethylmorpholin-4-yl)acetate.
What is the SMILES notation for methyl 2-(2,6-dimethylmorpholin-4-yl)acetate?
The canonical SMILES for methyl 2-(2,6-dimethylmorpholin-4-yl)acetate is COC(=O)CN1CC(C)OC(C)C1.
What is the InChIKey of methyl 2-(2,6-dimethylmorpholin-4-yl)acetate?
The InChIKey is SQMYBHLEAHRHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-7-4-10(5-8(2)13-7)6-9(11)12-3/h7-8H,4-6H2,1-3H3.
What are the key properties of methyl 2-(2,6-dimethylmorpholin-4-yl)acetate?
methyl 2-(2,6-dimethylmorpholin-4-yl)acetate has a molecular weight of 187.24 g/mol, XLogP of 0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-dimethylmorpholin-4-yl)acetate is sourced from PubChem (CID 22198251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).