C9H17NO3 — CID 22198251
methyl 2-(2,6-dimethylmorpholin-4-yl)acetate (PubChem CID 22198251) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is methyl 2-(2,6-dimethylmorpholin-4-yl)acetate.
| Compound Name | methyl 2-(2,6-dimethylmorpholin-4-yl)acetate |
|---|---|
| PubChem CID | 22198251 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | methyl 2-(2,6-dimethylmorpholin-4-yl)acetate |
| SMILES | COC(=O)CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C9H17NO3/c1-7-4-10(5-8(2)13-7)6-9(11)12-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | SQMYBHLEAHRHMZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |