C15H20N4O3 — CID 22198597
N-cyclopropyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 22198597) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22198597 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-cyclopropyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1)NC1CC1 |
| InChI | InChI=1S/C15H20N4O3/c20-15(16-12-1-2-12)11-17-7-9-18(10-8-17)13-3-5-14(6-4-13)19(21)22/h3-6,12H,1-2,7-11H2,(H,16,20) |
| InChIKey | QXAVGYHECRARES-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|