About 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole
2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole (PubChem CID 22200891) has the molecular formula C15H19NO2S
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole |
| PubChem CID | 22200891 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C15H19NO2S/c1-10-6-12(3)15(13(4)7-10)19(17,18)16-9-11(2)8-14(16)5/h6-9H,1-5H3 |
| InChIKey | AFZWZVLPIMHLSE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole?
The IUPAC name of 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole (CID 22200891) is 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole.
What is the SMILES notation for 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole?
The canonical SMILES for 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole is Cc1cc(C)c(S(=O)(=O)n2cc(C)cc2C)c(C)c1.
What is the InChIKey of 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole?
The InChIKey is AFZWZVLPIMHLSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2S/c1-10-6-12(3)15(13(4)7-10)19(17,18)16-9-11(2)8-14(16)5/h6-9H,1-5H3.
What are the key properties of 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole?
2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole has a molecular weight of 277.39 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-(2,4,6-trimethylphenyl)sulfonylpyrrole is sourced from PubChem (CID 22200891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).