C15H8F6N2O2S — CID 2220129
N-[3,5-bis(trifluoromethyl)phenyl]-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 2220129) has the molecular formula C15H8F6N2O2S and a molecular weight of 394.30 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 2220129 |
| Molecular Formula | C15H8F6N2O2S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C15H8F6N2O2S/c16-14(17,18)8-5-9(15(19,20)21)7-10(6-8)22-13-11-3-1-2-4-12(11)26(24,25)23-13/h1-7H,(H,22,23) |
| InChIKey | BMTRZTPPTZHACH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |