C14H20N4O2S2 — CID 22201666
1,3,5-trimethyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-4-sulfonamide (PubChem CID 22201666) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 1,3,5-trimethyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22201666 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1,3,5-trimethyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)Nc1nc2c(s1)CC(C)CC2 |
| InChI | InChI=1S/C14H20N4O2S2/c1-8-5-6-11-12(7-8)21-14(15-11)17-22(19,20)13-9(2)16-18(4)10(13)3/h8H,5-7H2,1-4H3,(H,15,17) |
| InChIKey | UCNBVPBMSFNRMM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |