About 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide
5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide (PubChem CID 22202487) has the molecular formula C10H10ClN3O2S2
and a molecular weight of 303.80 g/mol. Its IUPAC name is 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide |
| PubChem CID | 22202487 |
| Molecular Formula | C10H10ClN3O2S2 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C10H10ClN3O2S2/c1-6-5-7(2)13-10(12-6)14-18(15,16)9-4-3-8(11)17-9/h3-5H,1-2H3,(H,12,13,14) |
| InChIKey | XWALRFJSSMKWST-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide (CID 22202487) is 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide is Cc1cc(C)nc(NS(=O)(=O)c2ccc(Cl)s2)n1.
What is the InChIKey of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide?
The InChIKey is XWALRFJSSMKWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O2S2/c1-6-5-7(2)13-10(12-6)14-18(15,16)9-4-3-8(11)17-9/h3-5H,1-2H3,(H,12,13,14).
What are the key properties of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide?
5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide has a molecular weight of 303.80 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 22202487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).