C15H18F7NO4S — CID 22203475
N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]butane-1-sulfonamide (PubChem CID 22203475) has the molecular formula C15H18F7NO4S and a molecular weight of 441.37 g/mol. Its IUPAC name is N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]butane-1-sulfonamide.
| Compound Name | N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 22203475 |
| Molecular Formula | C15H18F7NO4S |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C15H18F7NO4S/c1-2-3-4-28(24,25)23-10-5-11(26-8-14(18,19)13(16)17)7-12(6-10)27-9-15(20,21)22/h5-7,13,23H,2-4,8-9H2,1H3 |
| InChIKey | UXZMHXDRLIYGDB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|