C16H10Cl3F6NO4S — CID 22203529
N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,4,5-trichlorobenzenesulfonamide (PubChem CID 22203529) has the molecular formula C16H10Cl3F6NO4S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 22203529 |
| Molecular Formula | C16H10Cl3F6NO4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 530.93 |
| IUPAC Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,4,5-trichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3F6NO4S/c17-11-4-13(19)14(5-12(11)18)31(27,28)26-8-1-9(29-6-15(20,21)22)3-10(2-8)30-7-16(23,24)25/h1-5,26H,6-7H2 |
| InChIKey | MLTRAQDTCKCRBJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|