C14H9F4N3O2S2 — CID 22205603
N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide (PubChem CID 22205603) has the molecular formula C14H9F4N3O2S2 and a molecular weight of 391.37 g/mol. Its IUPAC name is N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22205603 |
| Molecular Formula | C14H9F4N3O2S2 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)c1cccs1 |
| InChI | InChI=1S/C14H9F4N3O2S2/c15-9-6-10(16)14(18)8(13(9)17)7-21-4-3-11(19-21)20-25(22,23)12-2-1-5-24-12/h1-6H,7H2,(H,19,20) |
| InChIKey | NKOLFEZUCSAIGS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|