C14H8F5N3O2S2 — CID 22205650
N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide (PubChem CID 22205650) has the molecular formula C14H8F5N3O2S2 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22205650 |
| Molecular Formula | C14H8F5N3O2S2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1cccs1 |
| InChI | InChI=1S/C14H8F5N3O2S2/c15-10-7(11(16)13(18)14(19)12(10)17)6-22-4-3-8(20-22)21-26(23,24)9-2-1-5-25-9/h1-5H,6H2,(H,20,21) |
| InChIKey | MPLBNVOPOOCSMB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|