C14H14F5N3O2S — CID 22205657
N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide (PubChem CID 22205657) has the molecular formula C14H14F5N3O2S and a molecular weight of 383.34 g/mol. Its IUPAC name is N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide.
| Compound Name | N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 22205657 |
| Molecular Formula | C14H14F5N3O2S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C14H14F5N3O2S/c1-2-3-6-25(23,24)21-9-4-5-22(20-9)7-8-10(15)12(17)14(19)13(18)11(8)16/h4-5H,2-3,6-7H2,1H3,(H,20,21) |
| InChIKey | CTSPRISYXRIIJW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|