About N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide
N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide (PubChem CID 22206450) has the molecular formula C18H15BrCl2N4O3S
and a molecular weight of 518.22 g/mol. Its IUPAC name is N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide |
| PubChem CID | 22206450 |
| Molecular Formula | C18H15BrCl2N4O3S |
| Molecular Weight | 518.22 g/mol |
| Exact Mass | 515.94 |
| IUPAC Name | N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2nn(Cc3ccc(Cl)c(Cl)c3)cc2Br)cc1 |
| InChI | InChI=1S/C18H15BrCl2N4O3S/c1-11(26)22-13-3-5-14(6-4-13)29(27,28)24-18-15(19)10-25(23-18)9-12-2-7-16(20)17(21)8-12/h2-8,10H,9H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | ATKVUPPKAWGVAG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.22 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide?
The IUPAC name of N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide (CID 22206450) is N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide?
The canonical SMILES for N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide is CC(=O)Nc1ccc(S(=O)(=O)Nc2nn(Cc3ccc(Cl)c(Cl)c3)cc2Br)cc1.
What is the InChIKey of N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide?
The InChIKey is ATKVUPPKAWGVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrCl2N4O3S/c1-11(26)22-13-3-5-14(6-4-13)29(27,28)24-18-15(19)10-25(23-18)9-12-2-7-16(20)17(21)8-12/h2-8,10H,9H2,1H3,(H,22,26)(H,23,24).
What are the key properties of N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide?
N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide has a molecular weight of 518.22 g/mol, XLogP of 4.76, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]sulfamoyl]phenyl]acetamide is sourced from PubChem (CID 22206450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).