About 14-methylhexadecanoic acid
14-methylhexadecanoic acid (PubChem CID 22207) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 14-methylhexadecanoic acid.
Molecular Properties
| Compound Name | 14-methylhexadecanoic acid |
| PubChem CID | 22207 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 14-methylhexadecanoic acid |
| SMILES | CCC(C)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H34O2/c1-3-16(2)14-12-10-8-6-4-5-7-9-11-13-15-17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | FXUKWLSZZHVEJD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 14-methylhexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-methylhexadecanoic acid?
The IUPAC name of 14-methylhexadecanoic acid (CID 22207) is 14-methylhexadecanoic acid.
What is the SMILES notation for 14-methylhexadecanoic acid?
The canonical SMILES for 14-methylhexadecanoic acid is CCC(C)CCCCCCCCCCCCC(=O)O.
What is the InChIKey of 14-methylhexadecanoic acid?
The InChIKey is FXUKWLSZZHVEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-3-16(2)14-12-10-8-6-4-5-7-9-11-13-15-17(18)19/h16H,3-15H2,1-2H3,(H,18,19).
What are the key properties of 14-methylhexadecanoic acid?
14-methylhexadecanoic acid has a molecular weight of 270.46 g/mol, XLogP of 5.80, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 14-methylhexadecanoic acid is sourced from PubChem (CID 22207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).