About 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide
4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide (PubChem CID 22207405) has the molecular formula C15H20ClN3O2S
and a molecular weight of 341.86 g/mol. Its IUPAC name is 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide |
| PubChem CID | 22207405 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCn2nccc2C)c(C)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O2S/c1-11-10-15(12(2)9-14(11)16)22(20,21)18-6-4-8-19-13(3)5-7-17-19/h5,7,9-10,18H,4,6,8H2,1-3H3 |
| InChIKey | MRXMEAVHEPCXFW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide?
The IUPAC name of 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide (CID 22207405) is 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide.
What is the SMILES notation for 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide?
The canonical SMILES for 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide is Cc1cc(S(=O)(=O)NCCCn2nccc2C)c(C)cc1Cl.
What is the InChIKey of 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide?
The InChIKey is MRXMEAVHEPCXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN3O2S/c1-11-10-15(12(2)9-14(11)16)22(20,21)18-6-4-8-19-13(3)5-7-17-19/h5,7,9-10,18H,4,6,8H2,1-3H3.
What are the key properties of 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide?
4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide has a molecular weight of 341.86 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,5-dimethyl-N-[3-(5-methylpyrazol-1-yl)propyl]benzenesulfonamide is sourced from PubChem (CID 22207405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).