C13H16N4O4S — CID 22208876
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 22208876) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 22208876 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nn(C)cc1C(C)NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N4O4S/c1-9-13(8-16(3)14-9)10(2)15-22(20,21)12-6-4-5-11(7-12)17(18)19/h4-8,10,15H,1-3H3 |
| InChIKey | QAKIBOPNVJXULJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|