C15H9F2N3O3S — CID 22209646
(Z)-1-[5-(2,4-difluorophenyl)sulfanylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 22209646) has the molecular formula C15H9F2N3O3S and a molecular weight of 349.32 g/mol. Its IUPAC name is (Z)-1-[5-(2,4-difluorophenyl)sulfanylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-[5-(2,4-difluorophenyl)sulfanylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 22209646 |
| Molecular Formula | C15H9F2N3O3S |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (Z)-1-[5-(2,4-difluorophenyl)sulfanylfuran-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C(\O)c1ncn[nH]1)c1ccc(Sc2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C15H9F2N3O3S/c16-8-1-3-13(9(17)5-8)24-14-4-2-12(23-14)10(21)6-11(22)15-18-7-19-20-15/h1-7,22H,(H,18,19,20)/b11-6- |
| InChIKey | ZBYOOTYYNMQZFW-WDZFZDKYSA-N |
| XLogP | 3.61 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|