C22H20Cl2F3N5O5 — CID 22209825
3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,4,5-trifluoro-6-methylbenzoyl]amino]acetyl]amino]propanoic acid (PubChem CID 22209825) has the molecular formula C22H20Cl2F3N5O5 and a molecular weight of 562.33 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,4,5-trifluoro-6-methylbenzoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,4,5-trifluoro-6-methylbenzoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22209825 |
| Molecular Formula | C22H20Cl2F3N5O5 |
| Molecular Weight | 562.33 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | 3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,4,5-trifluoro-6-methylbenzoyl]amino]acetyl]amino]propanoic acid |
| SMILES | Cc1c(F)c(F)c(F)c(NC2=NCCN2)c1C(=O)NCC(=O)NC(CC(=O)O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C22H20Cl2F3N5O5/c1-8-15(19(18(27)17(26)16(8)25)32-22-28-2-3-29-22)21(37)30-7-13(33)31-12(6-14(34)35)10-4-9(23)5-11(24)20(10)36/h4-5,12,36H,2-3,6-7H2,1H3,(H,30,37)(H,31,33)(H,34,35)(H2,28,29,32) |
| InChIKey | QBHCJLSQVHSPGD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|