About 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide
8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 2220993) has the molecular formula C19H13ClN4O2
and a molecular weight of 364.79 g/mol. Its IUPAC name is 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide.
Molecular Properties
| Compound Name | 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide |
| PubChem CID | 2220993 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(-c3ccccn3)nc3c(Cl)cccc23)no1 |
| InChI | InChI=1S/C19H13ClN4O2/c1-11-9-17(24-26-11)23-19(25)13-10-16(15-7-2-3-8-21-15)22-18-12(13)5-4-6-14(18)20/h2-10H,1H3,(H,23,24,25) |
| InChIKey | BXPQQMVUQDWKQK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide?
The IUPAC name of 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide (CID 2220993) is 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide.
What is the SMILES notation for 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide?
The canonical SMILES for 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide is Cc1cc(NC(=O)c2cc(-c3ccccn3)nc3c(Cl)cccc23)no1.
What is the InChIKey of 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide?
The InChIKey is BXPQQMVUQDWKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClN4O2/c1-11-9-17(24-26-11)23-19(25)13-10-16(15-7-2-3-8-21-15)22-18-12(13)5-4-6-14(18)20/h2-10H,1H3,(H,23,24,25).
What are the key properties of 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide?
8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide has a molecular weight of 364.79 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-2-ylquinoline-4-carboxamide is sourced from PubChem (CID 2220993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).