C21H34O5 — CID 22209984
methyl 2-[(4R)-2',4,7,7-tetramethyl-1-(2-oxopropyl)spiro[1,3a,4,5,6,7a-hexahydro-2-benzofuran-3,5'-oxolane]-2'-yl]acetate (PubChem CID 22209984) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl 2-[(4R)-2',4,7,7-tetramethyl-1-(2-oxopropyl)spiro[1,3a,4,5,6,7a-hexahydro-2-benzofuran-3,5'-oxolane]-2'-yl]acetate.
| Compound Name | methyl 2-[(4R)-2',4,7,7-tetramethyl-1-(2-oxopropyl)spiro[1,3a,4,5,6,7a-hexahydro-2-benzofuran-3,5'-oxolane]-2'-yl]acetate |
|---|---|
| PubChem CID | 22209984 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | methyl 2-[(4R)-2',4,7,7-tetramethyl-1-(2-oxopropyl)spiro[1,3a,4,5,6,7a-hexahydro-2-benzofuran-3,5'-oxolane]-2'-yl]acetate |
| SMILES | COC(=O)CC1(C)CCC2(OC(CC(C)=O)C3C2C(C)CCC3(C)C)O1 |
| InChI | InChI=1S/C21H34O5/c1-13-7-8-19(3,4)18-15(11-14(2)22)25-21(17(13)18)10-9-20(5,26-21)12-16(23)24-6/h13,15,17-18H,7-12H2,1-6H3 |
| InChIKey | RWLFRYFHRCCQGN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |