C31H41NO8 — CID 22209999
[(1S,2R,3R,5R,9R,10R,11R,14S,18R)-5-hydroxy-6,17,19-trimethoxy-14-(methoxymethyl)-12-methyl-8-oxa-12-azaheptacyclo[8.7.2.12,5.01,11.03,9.07,9.014,18]icosan-4-yl] benzoate (PubChem CID 22209999) has the molecular formula C31H41NO8 and a molecular weight of 555.67 g/mol. Its IUPAC name is [(1S,2R,3R,5R,9R,10R,11R,14S,18R)-5-hydroxy-6,17,19-trimethoxy-14-(methoxymethyl)-12-methyl-8-oxa-12-azaheptacyclo[8.7.2.12,5.01,11.03,9.07,9.014,18]icosan-4-yl] benzoate.
| Compound Name | [(1S,2R,3R,5R,9R,10R,11R,14S,18R)-5-hydroxy-6,17,19-trimethoxy-14-(methoxymethyl)-12-methyl-8-oxa-12-azaheptacyclo[8.7.2.12,5.01,11.03,9.07,9.014,18]icosan-4-yl] benzoate |
|---|---|
| PubChem CID | 22209999 |
| Molecular Formula | C31H41NO8 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | [(1S,2R,3R,5R,9R,10R,11R,14S,18R)-5-hydroxy-6,17,19-trimethoxy-14-(methoxymethyl)-12-methyl-8-oxa-12-azaheptacyclo[8.7.2.12,5.01,11.03,9.07,9.014,18]icosan-4-yl] benzoate |
| SMILES | COC[C@@]12CCC(OC)[C@@]34[C@@H]5C[C@]6(O)C(OC)C7O[C@]7([C@H]5C6OC(=O)c5ccccc5)[C@@H](C(OC)[C@H]13)[C@H]4N(C)C2 |
| InChI | InChI=1S/C31H41NO8/c1-32-14-28(15-35-2)12-11-18(36-3)30-17-13-29(34)24(39-27(33)16-9-7-6-8-10-16)19(17)31(26(40-31)25(29)38-5)20(23(30)32)21(37-4)22(28)30/h6-10,17-26,34H,11-15H2,1-5H3/t17-,18?,19-,20+,21?,22-,23-,24?,25?,26?,28+,29-,30+,31-/m1/s1 |
| InChIKey | HTTIRIMDQHQFNT-LGFYTMKASA-N |
| XLogP | 1.76 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|