C16H22N2O6 — CID 22210193
1-N,3-N-dihydroxy-5-[(7-methyl-7-bicyclo[4.2.0]octanyl)oxycarbonyl]benzene-1,3-diamine oxide (PubChem CID 22210193) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-5-[(7-methyl-7-bicyclo[4.2.0]octanyl)oxycarbonyl]benzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dihydroxy-5-[(7-methyl-7-bicyclo[4.2.0]octanyl)oxycarbonyl]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 22210193 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-N,3-N-dihydroxy-5-[(7-methyl-7-bicyclo[4.2.0]octanyl)oxycarbonyl]benzene-1,3-diamine oxide |
| SMILES | CC1(OC(=O)c2cc([NH+]([O-])O)cc([NH+]([O-])O)c2)CC2CCCCC21 |
| InChI | InChI=1S/C16H22N2O6/c1-16(9-10-4-2-3-5-14(10)16)24-15(19)11-6-12(17(20)21)8-13(7-11)18(22)23/h6-8,10,14,17-18,20,22H,2-5,9H2,1H3 |
| InChIKey | NPTBBHPATJYZJT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|