C14H16N3O5- — CID 22210321
2-[hydroxy(oxido)amino]-5-(methoxymethyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 22210321) has the molecular formula C14H16N3O5- and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-[hydroxy(oxido)amino]-5-(methoxymethyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | 2-[hydroxy(oxido)amino]-5-(methoxymethyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 22210321 |
| Molecular Formula | C14H16N3O5- |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[hydroxy(oxido)amino]-5-(methoxymethyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COCN1C(=O)C2CCCN2C(=O)c2cc(N([O-])O)ccc21 |
| InChI | InChI=1S/C14H16N3O5/c1-22-8-16-11-5-4-9(17(20)21)7-10(11)13(18)15-6-2-3-12(15)14(16)19/h4-5,7,12,20H,2-3,6,8H2,1H3/q-1 |
| InChIKey | YBAYNFSXLNEBGI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|