C30H44O6 — CID 22210378
(5R,9R)-2-[[(3S,5R,7R)-3-ethyl-7-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 22210378) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (5R,9R)-2-[[(3S,5R,7R)-3-ethyl-7-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (5R,9R)-2-[[(3S,5R,7R)-3-ethyl-7-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22210378 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (5R,9R)-2-[[(3S,5R,7R)-3-ethyl-7-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CC[C@@H]1COC2C1C[C@H](OCC13CC4C(CC[C@H]4C)[C@]4(C=O)CC1C=C(C(C)C)C34C(=O)O)O[C@@H]2C |
| InChI | InChI=1S/C30H44O6/c1-6-19-13-34-26-18(5)36-25(10-21(19)26)35-15-29-12-22-17(4)7-8-23(22)28(14-31)11-20(29)9-24(16(2)3)30(28,29)27(32)33/h9,14,16-23,25-26H,6-8,10-13,15H2,1-5H3,(H,32,33)/t17-,18-,19-,20?,21?,22?,23?,25-,26?,28-,29?,30?/m1/s1 |
| InChIKey | MCYXNPCESIKEEI-ZYANVZJMSA-N |
| XLogP | 5.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|