C11H25O3Si2- — CID 22211712
2-methyl-2-trimethylsilyl-3-trimethylsilyloxybutanoate (PubChem CID 22211712) has the molecular formula C11H25O3Si2- and a molecular weight of 261.49 g/mol. Its IUPAC name is 2-methyl-2-trimethylsilyl-3-trimethylsilyloxybutanoate.
| Compound Name | 2-methyl-2-trimethylsilyl-3-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 22211712 |
| Molecular Formula | C11H25O3Si2- |
| Molecular Weight | 261.49 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-methyl-2-trimethylsilyl-3-trimethylsilyloxybutanoate |
| SMILES | CC(O[Si](C)(C)C)C(C)(C(=O)[O-])[Si](C)(C)C |
| InChI | InChI=1S/C11H26O3Si2/c1-9(14-16(6,7)8)11(2,10(12)13)15(3,4)5/h9H,1-8H3,(H,12,13)/p-1 |
| InChIKey | BOQBXYGOERGQII-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|