C31H56O2Si2 — CID 22211866
tert-butyl-[[(8R,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 22211866) has the molecular formula C31H56O2Si2 and a molecular weight of 516.96 g/mol. Its IUPAC name is tert-butyl-[[(8R,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8R,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 22211866 |
| Molecular Formula | C31H56O2Si2 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | tert-butyl-[[(8R,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=CC[C@H]3[C@@H]4CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H56O2Si2/c1-28(2,3)34(9,10)32-23-17-19-30(7)22(21-23)13-14-24-25-15-16-27(31(25,8)20-18-26(24)30)33-35(11,12)29(4,5)6/h13,21,24-27H,14-20H2,1-12H3/t24-,25-,26-,27-,30-,31-/m0/s1 |
| InChIKey | HAPKJTXIXLQIKC-AXOMYGEFSA-N |
| XLogP | 9.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|