About 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol
6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 22212414) has the molecular formula C7H7ClF6O
and a molecular weight of 256.57 g/mol. Its IUPAC name is 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol |
| PubChem CID | 22212414 |
| Molecular Formula | C7H7ClF6O |
| Molecular Weight | 256.57 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1C(Cl)CC(F)(C(F)(F)F)C(F)C1F |
| InChI | InChI=1S/C7H7ClF6O/c8-2-1-6(11,7(12,13)14)5(10)3(9)4(2)15/h2-5,15H,1H2 |
| InChIKey | WVBOXHWTBHTUQC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol?
The IUPAC name of 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol (CID 22212414) is 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol.
What is the SMILES notation for 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol?
The canonical SMILES for 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol is OC1C(Cl)CC(F)(C(F)(F)F)C(F)C1F.
What is the InChIKey of 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol?
The InChIKey is WVBOXHWTBHTUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClF6O/c8-2-1-6(11,7(12,13)14)5(10)3(9)4(2)15/h2-5,15H,1H2.
What are the key properties of 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol?
6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol has a molecular weight of 256.57 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3,4-trifluoro-4-(trifluoromethyl)cyclohexan-1-ol is sourced from PubChem (CID 22212414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).